C23H19FN2O2 — CID 71746186
benzyl N-[(6-fluoro-1H-indol-3-yl)-phenylmethyl]carbamate (PubChem CID 71746186) has the molecular formula C23H19FN2O2 and a molecular weight of 374.42 g/mol. Its IUPAC name is benzyl N-[(6-fluoro-1H-indol-3-yl)-phenylmethyl]carbamate.
| Compound Name | benzyl N-[(6-fluoro-1H-indol-3-yl)-phenylmethyl]carbamate |
|---|---|
| PubChem CID | 71746186 |
| Molecular Formula | C23H19FN2O2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | benzyl N-[(6-fluoro-1H-indol-3-yl)-phenylmethyl]carbamate |
| SMILES | O=C(NC(c1ccccc1)c1c[nH]c2cc(F)ccc12)OCc1ccccc1 |
| InChI | InChI=1S/C23H19FN2O2/c24-18-11-12-19-20(14-25-21(19)13-18)22(17-9-5-2-6-10-17)26-23(27)28-15-16-7-3-1-4-8-16/h1-14,22,25H,15H2,(H,26,27) |
| InChIKey | LNFOHHUHVOHSME-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |