C21H24N2O2 — CID 71746013
benzyl N-[1-(1H-indol-3-yl)-3-methylbutyl]carbamate (PubChem CID 71746013) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is benzyl N-[1-(1H-indol-3-yl)-3-methylbutyl]carbamate.
| Compound Name | benzyl N-[1-(1H-indol-3-yl)-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 71746013 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | benzyl N-[1-(1H-indol-3-yl)-3-methylbutyl]carbamate |
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H24N2O2/c1-15(2)12-20(18-13-22-19-11-7-6-10-17(18)19)23-21(24)25-14-16-8-4-3-5-9-16/h3-11,13,15,20,22H,12,14H2,1-2H3,(H,23,24) |
| InChIKey | CCRHSPCLFWIJFH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |