C19H18N2O4 — CID 34177615
(3R)-3-(1H-indol-3-yl)-3-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 34177615) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is (3R)-3-(1H-indol-3-yl)-3-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | (3R)-3-(1H-indol-3-yl)-3-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 34177615 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | (3R)-3-(1H-indol-3-yl)-3-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)OCc1ccccc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H18N2O4/c22-18(23)10-17(15-11-20-16-9-5-4-8-14(15)16)21-19(24)25-12-13-6-2-1-3-7-13/h1-9,11,17,20H,10,12H2,(H,21,24)(H,22,23)/t17-/m1/s1 |
| InChIKey | ICVQLSABHOWLCC-QGZVFWFLSA-N |
| XLogP | 3.61 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |