C17H18FNO3 — CID 59985516
benzyl N-[(1S)-1-(3-fluorophenyl)-3-hydroxypropyl]carbamate (PubChem CID 59985516) has the molecular formula C17H18FNO3 and a molecular weight of 303.33 g/mol. Its IUPAC name is benzyl N-[(1S)-1-(3-fluorophenyl)-3-hydroxypropyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-(3-fluorophenyl)-3-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 59985516 |
| Molecular Formula | C17H18FNO3 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | benzyl N-[(1S)-1-(3-fluorophenyl)-3-hydroxypropyl]carbamate |
| SMILES | O=C(N[C@@H](CCO)c1cccc(F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C17H18FNO3/c18-15-8-4-7-14(11-15)16(9-10-20)19-17(21)22-12-13-5-2-1-3-6-13/h1-8,11,16,20H,9-10,12H2,(H,19,21)/t16-/m0/s1 |
| InChIKey | BESYKMFEDRYIJQ-INIZCTEOSA-N |
| XLogP | 3.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |