C17H19NO5P+ — CID 172826308
hydroxy-oxo-[3-phenyl-3-(phenylmethoxycarbonylamino)propoxy]phosphanium (PubChem CID 172826308) has the molecular formula C17H19NO5P+ and a molecular weight of 348.32 g/mol. Its IUPAC name is hydroxy-oxo-[3-phenyl-3-(phenylmethoxycarbonylamino)propoxy]phosphanium.
| Compound Name | hydroxy-oxo-[3-phenyl-3-(phenylmethoxycarbonylamino)propoxy]phosphanium |
|---|---|
| PubChem CID | 172826308 |
| Molecular Formula | C17H19NO5P+ |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | hydroxy-oxo-[3-phenyl-3-(phenylmethoxycarbonylamino)propoxy]phosphanium |
| SMILES | O=C(NC(CCO[P+](=O)O)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C17H18NO5P/c19-17(22-13-14-7-3-1-4-8-14)18-16(11-12-23-24(20)21)15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H-,18,19,20,21)/p+1 |
| InChIKey | YOJRKKSNYLHPMC-UHFFFAOYSA-O |
| XLogP | 3.71 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|