C17H19NO5S — CID 142462159
[(2R)-2-phenyl-2-(phenylmethoxycarbonylamino)ethyl] methanesulfonate (PubChem CID 142462159) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is [(2R)-2-phenyl-2-(phenylmethoxycarbonylamino)ethyl] methanesulfonate.
| Compound Name | [(2R)-2-phenyl-2-(phenylmethoxycarbonylamino)ethyl] methanesulfonate |
|---|---|
| PubChem CID | 142462159 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | [(2R)-2-phenyl-2-(phenylmethoxycarbonylamino)ethyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H](NC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO5S/c1-24(20,21)23-13-16(15-10-6-3-7-11-15)18-17(19)22-12-14-8-4-2-5-9-14/h2-11,16H,12-13H2,1H3,(H,18,19)/t16-/m0/s1 |
| InChIKey | UKCHEICHXMJINJ-INIZCTEOSA-N |
| XLogP | 2.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|