C14H21NO5S — CID 129302825
[(2S)-2-(phenylmethoxycarbonylamino)pentyl] methanesulfonate (PubChem CID 129302825) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is [(2S)-2-(phenylmethoxycarbonylamino)pentyl] methanesulfonate.
| Compound Name | [(2S)-2-(phenylmethoxycarbonylamino)pentyl] methanesulfonate |
|---|---|
| PubChem CID | 129302825 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | [(2S)-2-(phenylmethoxycarbonylamino)pentyl] methanesulfonate |
| SMILES | CCC[C@@H](COS(C)(=O)=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H21NO5S/c1-3-7-13(11-20-21(2,17)18)15-14(16)19-10-12-8-5-4-6-9-12/h4-6,8-9,13H,3,7,10-11H2,1-2H3,(H,15,16)/t13-/m0/s1 |
| InChIKey | FGGQBZRLISSQNX-ZDUSSCGKSA-N |
| XLogP | 2.06 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|