C18H27NO7S — CID 175404112
benzyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfonyloxypentanoate (PubChem CID 175404112) has the molecular formula C18H27NO7S and a molecular weight of 401.48 g/mol. Its IUPAC name is benzyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfonyloxypentanoate.
| Compound Name | benzyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfonyloxypentanoate |
|---|---|
| PubChem CID | 175404112 |
| Molecular Formula | C18H27NO7S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | benzyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-methylsulfonyloxypentanoate |
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)OCc1ccccc1)COS(C)(=O)=O |
| InChI | InChI=1S/C18H27NO7S/c1-18(2,3)26-17(21)19-15(13-25-27(4,22)23)10-11-16(20)24-12-14-8-6-5-7-9-14/h5-9,15H,10-13H2,1-4H3,(H,19,21) |
| InChIKey | PKTKVGHRYCTCQA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|