C20H32N2O7S — CID 135204248
[6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexyl] methanesulfonate (PubChem CID 135204248) has the molecular formula C20H32N2O7S and a molecular weight of 444.55 g/mol. Its IUPAC name is [6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexyl] methanesulfonate.
| Compound Name | [6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexyl] methanesulfonate |
|---|---|
| PubChem CID | 135204248 |
| Molecular Formula | C20H32N2O7S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(COS(C)(=O)=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H32N2O7S/c1-20(2,3)29-18(23)21-13-9-8-12-17(15-28-30(4,25)26)22-19(24)27-14-16-10-6-5-7-11-16/h5-7,10-11,17H,8-9,12-15H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | GZUCDHMCVDUNDF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|