C24H37N3O7 — CID 11329087
(3S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[[(3S)-3-(phenylmethoxycarbonylamino)butanoyl]amino]heptanoic acid (PubChem CID 11329087) has the molecular formula C24H37N3O7 and a molecular weight of 479.57 g/mol. Its IUPAC name is (3S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[[(3S)-3-(phenylmethoxycarbonylamino)butanoyl]amino]heptanoic acid.
| Compound Name | (3S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[[(3S)-3-(phenylmethoxycarbonylamino)butanoyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 11329087 |
| Molecular Formula | C24H37N3O7 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | (3S)-7-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[[(3S)-3-(phenylmethoxycarbonylamino)butanoyl]amino]heptanoic acid |
| SMILES | C[C@@H](CC(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)CC(=O)O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H37N3O7/c1-17(26-23(32)33-16-18-10-6-5-7-11-18)14-20(28)27-19(15-21(29)30)12-8-9-13-25-22(31)34-24(2,3)4/h5-7,10-11,17,19H,8-9,12-16H2,1-4H3,(H,25,31)(H,26,32)(H,27,28)(H,29,30)/t17-,19-/m0/s1 |
| InChIKey | ZYNFBWYQQZGDPD-HKUYNNGSSA-N |
| XLogP | 3.35 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|