C34H47N3O9 — CID 11802275
benzyl (2S)-2-[[(3R)-3-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]oxybutanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 11802275) has the molecular formula C34H47N3O9 and a molecular weight of 641.76 g/mol. Its IUPAC name is benzyl (2S)-2-[[(3R)-3-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]oxybutanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | benzyl (2S)-2-[[(3R)-3-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]oxybutanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 11802275 |
| Molecular Formula | C34H47N3O9 |
| Molecular Weight | 641.76 g/mol |
| Exact Mass | 641.33 |
| IUPAC Name | benzyl (2S)-2-[[(3R)-3-[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]oxybutanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | C[C@H](CC(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)OC(=O)C[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H47N3O9/c1-24(36-33(42)46-34(3,4)5)20-30(39)45-25(2)21-29(38)37-28(31(40)43-22-26-14-8-6-9-15-26)18-12-13-19-35-32(41)44-23-27-16-10-7-11-17-27/h6-11,14-17,24-25,28H,12-13,18-23H2,1-5H3,(H,35,41)(H,36,42)(H,37,38)/t24-,25+,28-/m0/s1 |
| InChIKey | SLCWXKSDIZOOLQ-OARDWFSCSA-N |
| XLogP | 4.94 |
| TPSA | 158.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.76 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|