C41H52N4O8 — CID 11297127
(3S)-3-[[(3S)-3-[[(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]amino]-7-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoyl]amino]-4-phenylbutanoic acid (PubChem CID 11297127) has the molecular formula C41H52N4O8 and a molecular weight of 728.89 g/mol. Its IUPAC name is (3S)-3-[[(3S)-3-[[(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]amino]-7-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoyl]amino]-4-phenylbutanoic acid.
| Compound Name | (3S)-3-[[(3S)-3-[[(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]amino]-7-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 11297127 |
| Molecular Formula | C41H52N4O8 |
| Molecular Weight | 728.89 g/mol |
| Exact Mass | 728.38 |
| IUPAC Name | (3S)-3-[[(3S)-3-[[(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoyl]amino]-7-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoyl]amino]-4-phenylbutanoic acid |
| SMILES | C[C@@H](CC(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)CC(=O)N[C@H](CC(=O)O)Cc1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C41H52N4O8/c1-27(43-40(51)52-26-35-33-19-10-8-17-31(33)32-18-9-11-20-34(32)35)22-36(46)44-29(16-12-13-21-42-39(50)53-41(2,3)4)24-37(47)45-30(25-38(48)49)23-28-14-6-5-7-15-28/h5-11,14-15,17-20,27,29-30,35H,12-13,16,21-26H2,1-4H3,(H,42,50)(H,43,51)(H,44,46)(H,45,47)(H,48,49)/t27-,29-,30-/m0/s1 |
| InChIKey | BDMCLIMWAZOKSL-BKHJTQGXSA-N |
| XLogP | 6.08 |
| TPSA | 172.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.89 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|