C34H57N5O9 — CID 86624517
benzyl N-[(4S)-6-[[(2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamate (PubChem CID 86624517) has the molecular formula C34H57N5O9 and a molecular weight of 679.86 g/mol. Its IUPAC name is benzyl N-[(4S)-6-[[(2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[(4S)-6-[[(2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 86624517 |
| Molecular Formula | C34H57N5O9 |
| Molecular Weight | 679.86 g/mol |
| Exact Mass | 679.42 |
| IUPAC Name | benzyl N-[(4S)-6-[[(2S)-2,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC[C@@H](CNC(=O)C[C@H](CCCNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H57N5O9/c1-32(2,3)46-29(42)36-20-14-18-26(39-31(44)48-34(7,8)9)22-37-27(40)21-25(38-30(43)47-33(4,5)6)17-13-19-35-28(41)45-23-24-15-11-10-12-16-24/h10-12,15-16,25-26H,13-14,17-23H2,1-9H3,(H,35,41)(H,36,42)(H,37,40)(H,38,43)(H,39,44)/t25-,26-/m0/s1 |
| InChIKey | XNJPDFVFHSGLET-UIOOFZCWSA-N |
| XLogP | 5.29 |
| TPSA | 182.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.86 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|