C19H32N2O7S — CID 174885658
benzyl 2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;methanesulfonic acid (PubChem CID 174885658) has the molecular formula C19H32N2O7S and a molecular weight of 432.54 g/mol. Its IUPAC name is benzyl 2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;methanesulfonic acid.
| Compound Name | benzyl 2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;methanesulfonic acid |
|---|---|
| PubChem CID | 174885658 |
| Molecular Formula | C19H32N2O7S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | benzyl 2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;methanesulfonic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCC(N)C(=O)OCc1ccccc1.CS(=O)(=O)O |
| InChI | InChI=1S/C18H28N2O4.CH4O3S/c1-18(2,3)24-17(22)20-12-8-7-11-15(19)16(21)23-13-14-9-5-4-6-10-14;1-5(2,3)4/h4-6,9-10,15H,7-8,11-13,19H2,1-3H3,(H,20,22);1H3,(H,2,3,4) |
| InChIKey | DVOUXFMPKMHYQJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|