C20H34N2O7S — CID 86641208
methanesulfonate;trimethyl-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutyl]azanium (PubChem CID 86641208) has the molecular formula C20H34N2O7S and a molecular weight of 446.57 g/mol. Its IUPAC name is methanesulfonate;trimethyl-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutyl]azanium.
| Compound Name | methanesulfonate;trimethyl-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutyl]azanium |
|---|---|
| PubChem CID | 86641208 |
| Molecular Formula | C20H34N2O7S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | methanesulfonate;trimethyl-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutyl]azanium |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)OCc1ccccc1)C[N+](C)(C)C.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C19H30N2O4.CH4O3S/c1-19(2,3)25-18(23)20-16(13-21(4,5)6)12-17(22)24-14-15-10-8-7-9-11-15;1-5(2,3)4/h7-11,16H,12-14H2,1-6H3;1H3,(H,2,3,4)/t16-;/m1./s1 |
| InChIKey | BZHDWCJGDIHNBQ-PKLMIRHRSA-N |
| XLogP | 1.88 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|