C21H32N2O6 — CID 71546640
benzyl (3R,4S)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(nitromethyl)heptanoate (PubChem CID 71546640) has the molecular formula C21H32N2O6 and a molecular weight of 408.50 g/mol. Its IUPAC name is benzyl (3R,4S)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(nitromethyl)heptanoate.
| Compound Name | benzyl (3R,4S)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(nitromethyl)heptanoate |
|---|---|
| PubChem CID | 71546640 |
| Molecular Formula | C21H32N2O6 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | benzyl (3R,4S)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(nitromethyl)heptanoate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)[C@H](CC(=O)OCc1ccccc1)C[N+](=O)[O-] |
| InChI | InChI=1S/C21H32N2O6/c1-15(2)11-18(22-20(25)29-21(3,4)5)17(13-23(26)27)12-19(24)28-14-16-9-7-6-8-10-16/h6-10,15,17-18H,11-14H2,1-5H3,(H,22,25)/t17-,18+/m1/s1 |
| InChIKey | FFSOYDSELOARQN-MSOLQXFVSA-N |
| XLogP | 3.95 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|