C19H30N2O5 — CID 66969578
benzyl (3S)-4-(2-hydroxypropylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 66969578) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is benzyl (3S)-4-(2-hydroxypropylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | benzyl (3S)-4-(2-hydroxypropylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 66969578 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | benzyl (3S)-4-(2-hydroxypropylamino)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(O)CNC[C@H](CC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30N2O5/c1-14(22)11-20-12-16(21-18(24)26-19(2,3)4)10-17(23)25-13-15-8-6-5-7-9-15/h5-9,14,16,20,22H,10-13H2,1-4H3,(H,21,24)/t14?,16-/m0/s1 |
| InChIKey | OSDYQCJXLDPQSB-WMCAAGNKSA-N |
| XLogP | 1.98 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |