C28H33NO5 — CID 44596383
benzyl N-[1-[bis(4-methoxyphenyl)methoxy]pentan-2-yl]carbamate (PubChem CID 44596383) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is benzyl N-[1-[bis(4-methoxyphenyl)methoxy]pentan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[bis(4-methoxyphenyl)methoxy]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 44596383 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | benzyl N-[1-[bis(4-methoxyphenyl)methoxy]pentan-2-yl]carbamate |
| SMILES | CCCC(COC(c1ccc(OC)cc1)c1ccc(OC)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H33NO5/c1-4-8-24(29-28(30)34-19-21-9-6-5-7-10-21)20-33-27(22-11-15-25(31-2)16-12-22)23-13-17-26(32-3)18-14-23/h5-7,9-18,24,27H,4,8,19-20H2,1-3H3,(H,29,30) |
| InChIKey | SRPGXILIPLKLPH-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |