C13H19NO5S — CID 89158440
1-(phenylmethoxycarbonylamino)butyl methanesulfonate (PubChem CID 89158440) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is 1-(phenylmethoxycarbonylamino)butyl methanesulfonate.
| Compound Name | 1-(phenylmethoxycarbonylamino)butyl methanesulfonate |
|---|---|
| PubChem CID | 89158440 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1-(phenylmethoxycarbonylamino)butyl methanesulfonate |
| SMILES | CCCC(NC(=O)OCc1ccccc1)OS(C)(=O)=O |
| InChI | InChI=1S/C13H19NO5S/c1-3-7-12(19-20(2,16)17)14-13(15)18-10-11-8-5-4-6-9-11/h4-6,8-9,12H,3,7,10H2,1-2H3,(H,14,15) |
| InChIKey | PDRBAWXVLALTOR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|