C13H17NO4 — CID 87244341
2-deuterio-2-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 87244341) has the molecular formula C13H17NO4 and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-deuterio-2-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 2-deuterio-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 87244341 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-deuterio-2-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | [2H]C(CCC)(NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H17NO4/c1-2-6-11(12(15)16)14-13(17)18-9-10-7-4-3-5-8-10/h3-5,7-8,11H,2,6,9H2,1H3,(H,14,17)(H,15,16)/i11D |
| InChIKey | NSJDRLWFFAWSFP-WORMITQPSA-N |
| XLogP | 2.17 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |