C18H27NO6 — CID 118194605
2,2-diethoxy-3-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 118194605) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is 2,2-diethoxy-3-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | 2,2-diethoxy-3-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 118194605 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 2,2-diethoxy-3-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | CCCC(NC(=O)OCc1ccccc1)C(OCC)(OCC)C(=O)O |
| InChI | InChI=1S/C18H27NO6/c1-4-10-15(18(16(20)21,24-5-2)25-6-3)19-17(22)23-13-14-11-8-7-9-12-14/h7-9,11-12,15H,4-6,10,13H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | WOCPOKHJVMYOAA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|