C22H31NO6 — CID 11962064
diethyl 2-[1-(phenylmethoxycarbonylamino)butyl]-2-prop-2-enylpropanedioate (PubChem CID 11962064) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is diethyl 2-[1-(phenylmethoxycarbonylamino)butyl]-2-prop-2-enylpropanedioate.
| Compound Name | diethyl 2-[1-(phenylmethoxycarbonylamino)butyl]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 11962064 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | diethyl 2-[1-(phenylmethoxycarbonylamino)butyl]-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(C(=O)OCC)(C(=O)OCC)C(CCC)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H31NO6/c1-5-12-18(23-21(26)29-16-17-13-10-9-11-14-17)22(15-6-2,19(24)27-7-3)20(25)28-8-4/h6,9-11,13-14,18H,2,5,7-8,12,15-16H2,1,3-4H3,(H,23,26) |
| InChIKey | NYSHQRUDTTWSIX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|