C19H27NO4S — CID 138979505
methyl (2S)-2-methyl-2-[(1S)-3-methylsulfanyl-1-(phenylmethoxycarbonylamino)propyl]pent-4-enoate (PubChem CID 138979505) has the molecular formula C19H27NO4S and a molecular weight of 365.50 g/mol. Its IUPAC name is methyl (2S)-2-methyl-2-[(1S)-3-methylsulfanyl-1-(phenylmethoxycarbonylamino)propyl]pent-4-enoate.
| Compound Name | methyl (2S)-2-methyl-2-[(1S)-3-methylsulfanyl-1-(phenylmethoxycarbonylamino)propyl]pent-4-enoate |
|---|---|
| PubChem CID | 138979505 |
| Molecular Formula | C19H27NO4S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | methyl (2S)-2-methyl-2-[(1S)-3-methylsulfanyl-1-(phenylmethoxycarbonylamino)propyl]pent-4-enoate |
| SMILES | C=CC[C@](C)(C(=O)OC)[C@H](CCSC)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H27NO4S/c1-5-12-19(2,17(21)23-3)16(11-13-25-4)20-18(22)24-14-15-9-7-6-8-10-15/h5-10,16H,1,11-14H2,2-4H3,(H,20,22)/t16-,19-/m0/s1 |
| InChIKey | LWGYTWMUOUUSQT-LPHOPBHVSA-N |
| XLogP | 3.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|