C16H21NO4S — CID 10903408
methyl (E,4S)-6-methylsulfanyl-4-(phenylmethoxycarbonylamino)hex-2-enoate (PubChem CID 10903408) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is methyl (E,4S)-6-methylsulfanyl-4-(phenylmethoxycarbonylamino)hex-2-enoate.
| Compound Name | methyl (E,4S)-6-methylsulfanyl-4-(phenylmethoxycarbonylamino)hex-2-enoate |
|---|---|
| PubChem CID | 10903408 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | methyl (E,4S)-6-methylsulfanyl-4-(phenylmethoxycarbonylamino)hex-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](CCSC)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21NO4S/c1-20-15(18)9-8-14(10-11-22-2)17-16(19)21-12-13-6-4-3-5-7-13/h3-9,14H,10-12H2,1-2H3,(H,17,19)/b9-8+/t14-/m1/s1 |
| InChIKey | CIUOCXWOBGXRAJ-MYSGNRETSA-N |
| XLogP | 2.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|