C16H21NO3S — CID 46176646
benzyl N-[(3S)-1-methylsulfanyl-4-oxohept-6-en-3-yl]carbamate (PubChem CID 46176646) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is benzyl N-[(3S)-1-methylsulfanyl-4-oxohept-6-en-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-1-methylsulfanyl-4-oxohept-6-en-3-yl]carbamate |
|---|---|
| PubChem CID | 46176646 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | benzyl N-[(3S)-1-methylsulfanyl-4-oxohept-6-en-3-yl]carbamate |
| SMILES | C=CCC(=O)[C@H](CCSC)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21NO3S/c1-3-7-15(18)14(10-11-21-2)17-16(19)20-12-13-8-5-4-6-9-13/h3-6,8-9,14H,1,7,10-12H2,2H3,(H,17,19)/t14-/m0/s1 |
| InChIKey | VHKXZNTWGIGJCI-AWEZNQCLSA-N |
| XLogP | 3.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|