C20H29NO3S — CID 158928926
benzyl N-[(3S)-1-(3-methylcyclopentyl)-5-methylsulfanyl-2-oxopentan-3-yl]carbamate (PubChem CID 158928926) has the molecular formula C20H29NO3S and a molecular weight of 363.52 g/mol. Its IUPAC name is benzyl N-[(3S)-1-(3-methylcyclopentyl)-5-methylsulfanyl-2-oxopentan-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-1-(3-methylcyclopentyl)-5-methylsulfanyl-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 158928926 |
| Molecular Formula | C20H29NO3S |
| Molecular Weight | 363.52 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | benzyl N-[(3S)-1-(3-methylcyclopentyl)-5-methylsulfanyl-2-oxopentan-3-yl]carbamate |
| SMILES | CSCC[C@H](NC(=O)OCc1ccccc1)C(=O)CC1CCC(C)C1 |
| InChI | InChI=1S/C20H29NO3S/c1-15-8-9-17(12-15)13-19(22)18(10-11-25-2)21-20(23)24-14-16-6-4-3-5-7-16/h3-7,15,17-18H,8-14H2,1-2H3,(H,21,23)/t15?,17?,18-/m0/s1 |
| InChIKey | KAJLHRMOXZNMNF-VJFUWPCTSA-N |
| XLogP | 4.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |