C18H23N3O3S — CID 146036334
benzyl N-[(2S)-1-(1-cyanopyrrolidin-2-yl)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate (PubChem CID 146036334) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(1-cyanopyrrolidin-2-yl)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(1-cyanopyrrolidin-2-yl)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 146036334 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | benzyl N-[(2S)-1-(1-cyanopyrrolidin-2-yl)-4-methylsulfanyl-1-oxobutan-2-yl]carbamate |
| SMILES | CSCC[C@H](NC(=O)OCc1ccccc1)C(=O)C1CCCN1C#N |
| InChI | InChI=1S/C18H23N3O3S/c1-25-11-9-15(17(22)16-8-5-10-21(16)13-19)20-18(23)24-12-14-6-3-2-4-7-14/h2-4,6-7,15-16H,5,8-12H2,1H3,(H,20,23)/t15-,16?/m0/s1 |
| InChIKey | HFKIFTLSZSNUDM-VYRBHSGPSA-N |
| XLogP | 2.55 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|