C19H25N3O3 — CID 59123211
benzyl (2S)-2-[(1-cyanopyrrolidine-2-carbonyl)amino]-4-methylpentanoate (PubChem CID 59123211) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is benzyl (2S)-2-[(1-cyanopyrrolidine-2-carbonyl)amino]-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-[(1-cyanopyrrolidine-2-carbonyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 59123211 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | benzyl (2S)-2-[(1-cyanopyrrolidine-2-carbonyl)amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)C1CCCN1C#N)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H25N3O3/c1-14(2)11-16(19(24)25-12-15-7-4-3-5-8-15)21-18(23)17-9-6-10-22(17)13-20/h3-5,7-8,14,16-17H,6,9-12H2,1-2H3,(H,21,23)/t16-,17?/m0/s1 |
| InChIKey | ABXDXHOBYQAKGN-BHWOMJMDSA-N |
| XLogP | 2.21 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|