C20H30N2O3 — CID 10665277
benzyl (2S)-2-[[(2R)-2-amino-2-cyclopentylacetyl]amino]-4-methylpentanoate (PubChem CID 10665277) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2R)-2-amino-2-cyclopentylacetyl]amino]-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-[[(2R)-2-amino-2-cyclopentylacetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 10665277 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | benzyl (2S)-2-[[(2R)-2-amino-2-cyclopentylacetyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](N)C1CCCC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H30N2O3/c1-14(2)12-17(20(24)25-13-15-8-4-3-5-9-15)22-19(23)18(21)16-10-6-7-11-16/h3-5,8-9,14,16-18H,6-7,10-13,21H2,1-2H3,(H,22,23)/t17-,18+/m0/s1 |
| InChIKey | JPOATHMJPXGSES-ZWKOTPCHSA-N |
| XLogP | 2.78 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |