C30H46N4O7 — CID 154533429
benzyl (2S)-2-[[2-[[(2S)-5-amino-2-[[(2S)-2-cyclohexylpropanoyl]amino]-5-oxopentanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoate (PubChem CID 154533429) has the molecular formula C30H46N4O7 and a molecular weight of 574.72 g/mol. Its IUPAC name is benzyl (2S)-2-[[2-[[(2S)-5-amino-2-[[(2S)-2-cyclohexylpropanoyl]amino]-5-oxopentanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-[[2-[[(2S)-5-amino-2-[[(2S)-2-cyclohexylpropanoyl]amino]-5-oxopentanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 154533429 |
| Molecular Formula | C30H46N4O7 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | benzyl (2S)-2-[[2-[[(2S)-5-amino-2-[[(2S)-2-cyclohexylpropanoyl]amino]-5-oxopentanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)C(CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](C)C1CCCCC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H46N4O7/c1-19(2)16-24(30(40)41-18-21-10-6-4-7-11-21)33-29(39)25(17-35)34-28(38)23(14-15-26(31)36)32-27(37)20(3)22-12-8-5-9-13-22/h4,6-7,10-11,19-20,22-25,35H,5,8-9,12-18H2,1-3H3,(H2,31,36)(H,32,37)(H,33,39)(H,34,38)/t20-,23-,24-,25?/m0/s1 |
| InChIKey | GMRZZWNWZNJLNN-ZSSNFGTDSA-N |
| XLogP | 1.70 |
| TPSA | 176.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |