C34H53N5O9 — CID 142060041
benzyl (2S)-2-[[(2S)-2-[[(2S)-5-amino-2-[[2-[cyclohexyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]-5-oxopentanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoate (PubChem CID 142060041) has the molecular formula C34H53N5O9 and a molecular weight of 675.82 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-2-[[(2S)-5-amino-2-[[2-[cyclohexyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]-5-oxopentanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-2-[[(2S)-5-amino-2-[[2-[cyclohexyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]-5-oxopentanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 142060041 |
| Molecular Formula | C34H53N5O9 |
| Molecular Weight | 675.82 g/mol |
| Exact Mass | 675.38 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-2-[[(2S)-5-amino-2-[[2-[cyclohexyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetyl]amino]-5-oxopentanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)CN(C(=O)OC(C)(C)C)C1CCCCC1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H53N5O9/c1-22(2)18-26(32(45)47-21-23-12-8-6-9-13-23)37-31(44)27(20-40)38-30(43)25(16-17-28(35)41)36-29(42)19-39(24-14-10-7-11-15-24)33(46)48-34(3,4)5/h6,8-9,12-13,22,24-27,40H,7,10-11,14-21H2,1-5H3,(H2,35,41)(H,36,42)(H,37,44)(H,38,43)/t25-,26-,27-/m0/s1 |
| InChIKey | QJAVDTBQSTYBLU-QKDODKLFSA-N |
| XLogP | 2.06 |
| TPSA | 206.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.82 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |