C17H25N3O2 — CID 11067759
(2S)-2-[[(2S)-2-amino-2-cyclohexylacetyl]amino]-3-phenylpropanamide (PubChem CID 11067759) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-2-cyclohexylacetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-2-[[(2S)-2-amino-2-cyclohexylacetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 11067759 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-2-cyclohexylacetyl]amino]-3-phenylpropanamide |
| SMILES | NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)C1CCCCC1 |
| InChI | InChI=1S/C17H25N3O2/c18-15(13-9-5-2-6-10-13)17(22)20-14(16(19)21)11-12-7-3-1-4-8-12/h1,3-4,7-8,13-15H,2,5-6,9-11,18H2,(H2,19,21)(H,20,22)/t14-,15-/m0/s1 |
| InChIKey | JSSNSVUKLPHEPZ-GJZGRUSLSA-N |
| XLogP | 1.11 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |