C21H31NO3 — CID 158818814
benzyl N-[(3S)-5-methyl-1-(3-methylcyclopentyl)-2-oxohexan-3-yl]carbamate (PubChem CID 158818814) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is benzyl N-[(3S)-5-methyl-1-(3-methylcyclopentyl)-2-oxohexan-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-5-methyl-1-(3-methylcyclopentyl)-2-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 158818814 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | benzyl N-[(3S)-5-methyl-1-(3-methylcyclopentyl)-2-oxohexan-3-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)CC1CCC(C)C1 |
| InChI | InChI=1S/C21H31NO3/c1-15(2)11-19(20(23)13-18-10-9-16(3)12-18)22-21(24)25-14-17-7-5-4-6-8-17/h4-8,15-16,18-19H,9-14H2,1-3H3,(H,22,24)/t16?,18?,19-/m0/s1 |
| InChIKey | VIPWSTRBUYCYCX-KVZIAJEVSA-N |
| XLogP | 4.72 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |