C19H18Cl3NO4S — CID 102428362
(2,4,6-trichlorophenyl) (2S)-4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 102428362) has the molecular formula C19H18Cl3NO4S and a molecular weight of 462.78 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) (2S)-4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | (2,4,6-trichlorophenyl) (2S)-4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 102428362 |
| Molecular Formula | C19H18Cl3NO4S |
| Molecular Weight | 462.78 g/mol |
| Exact Mass | 461.00 |
| IUPAC Name | (2,4,6-trichlorophenyl) (2S)-4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CSCC[C@H](NC(=O)OCc1ccccc1)C(=O)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C19H18Cl3NO4S/c1-28-8-7-16(23-19(25)26-11-12-5-3-2-4-6-12)18(24)27-17-14(21)9-13(20)10-15(17)22/h2-6,9-10,16H,7-8,11H2,1H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | VJQGVFHOHPPJDE-INIZCTEOSA-N |
| XLogP | 5.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.78 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|