C23H34N2O6 — CID 10574846
tert-butyl (E)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hex-2-enoate (PubChem CID 10574846) has the molecular formula C23H34N2O6 and a molecular weight of 434.53 g/mol. Its IUPAC name is tert-butyl (E)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hex-2-enoate.
| Compound Name | tert-butyl (E)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hex-2-enoate |
|---|---|
| PubChem CID | 10574846 |
| Molecular Formula | C23H34N2O6 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | tert-butyl (E)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hex-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/C(CCNC(=O)OCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H34N2O6/c1-22(2,3)30-19(26)13-12-18(25-21(28)31-23(4,5)6)14-15-24-20(27)29-16-17-10-8-7-9-11-17/h7-13,18H,14-16H2,1-6H3,(H,24,27)(H,25,28)/b13-12+ |
| InChIKey | UDMCGBFYLKCFMS-OUKQBFOZSA-N |
| XLogP | 4.09 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|