C23H36N2O4 — CID 51348114
tert-butyl (E,4S)-4-(benzylamino)-7-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoate (PubChem CID 51348114) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is tert-butyl (E,4S)-4-(benzylamino)-7-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoate.
| Compound Name | tert-butyl (E,4S)-4-(benzylamino)-7-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoate |
|---|---|
| PubChem CID | 51348114 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | tert-butyl (E,4S)-4-(benzylamino)-7-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/[C@H](CCCNC(=O)OC(C)(C)C)NCc1ccccc1 |
| InChI | InChI=1S/C23H36N2O4/c1-22(2,3)28-20(26)15-14-19(25-17-18-11-8-7-9-12-18)13-10-16-24-21(27)29-23(4,5)6/h7-9,11-12,14-15,19,25H,10,13,16-17H2,1-6H3,(H,24,27)/b15-14+/t19-/m0/s1 |
| InChIKey | ZXKGDURVYOQVIS-IQGVVSCOSA-N |
| XLogP | 4.35 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|