C19H27NO5 — CID 134864361
ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypent-2-enoate (PubChem CID 134864361) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypent-2-enoate.
| Compound Name | ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypent-2-enoate |
|---|---|
| PubChem CID | 134864361 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | ethyl (E,4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](COCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27NO5/c1-5-24-17(21)12-11-16(20-18(22)25-19(2,3)4)14-23-13-15-9-7-6-8-10-15/h6-12,16H,5,13-14H2,1-4H3,(H,20,22)/b12-11+/t16-/m0/s1 |
| InChIKey | CEXRFYDYJGWEAF-PCUGXKRQSA-N |
| XLogP | 3.22 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|