C32H36N2O5 — CID 162388027
ethyl (E,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-6-(tritylamino)hex-2-enoate (PubChem CID 162388027) has the molecular formula C32H36N2O5 and a molecular weight of 528.65 g/mol. Its IUPAC name is ethyl (E,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-6-(tritylamino)hex-2-enoate.
| Compound Name | ethyl (E,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-6-(tritylamino)hex-2-enoate |
|---|---|
| PubChem CID | 162388027 |
| Molecular Formula | C32H36N2O5 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | ethyl (E,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-6-(tritylamino)hex-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H](CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H36N2O5/c1-5-38-29(36)22-21-27(33-30(37)39-31(2,3)4)23-28(35)34-32(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-22,27H,5,23H2,1-4H3,(H,33,37)(H,34,35)/b22-21+/t27-/m0/s1 |
| InChIKey | MFBQMPQZJOVQEO-BZNVDEBGSA-N |
| XLogP | 5.50 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|