C34H37N3O6 — CID 10507525
tert-butyl N-[(E,4S)-1,7-dioxo-1-(2-oxo-1,3-oxazolidin-3-yl)-7-(tritylamino)hept-2-en-4-yl]carbamate (PubChem CID 10507525) has the molecular formula C34H37N3O6 and a molecular weight of 583.68 g/mol. Its IUPAC name is tert-butyl N-[(E,4S)-1,7-dioxo-1-(2-oxo-1,3-oxazolidin-3-yl)-7-(tritylamino)hept-2-en-4-yl]carbamate.
| Compound Name | tert-butyl N-[(E,4S)-1,7-dioxo-1-(2-oxo-1,3-oxazolidin-3-yl)-7-(tritylamino)hept-2-en-4-yl]carbamate |
|---|---|
| PubChem CID | 10507525 |
| Molecular Formula | C34H37N3O6 |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.27 |
| IUPAC Name | tert-butyl N-[(E,4S)-1,7-dioxo-1-(2-oxo-1,3-oxazolidin-3-yl)-7-(tritylamino)hept-2-en-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](/C=C/C(=O)N1CCOC1=O)CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H37N3O6/c1-33(2,3)43-31(40)35-28(20-22-30(39)37-23-24-42-32(37)41)19-21-29(38)36-34(25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27/h4-18,20,22,28H,19,21,23-24H2,1-3H3,(H,35,40)(H,36,38)/b22-20+/t28-/m0/s1 |
| InChIKey | BNQXAWKEKXLTLB-FUZQEDAYSA-N |
| XLogP | 5.30 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|