C47H56N4O7 — CID 11007272
ethyl (E,4S)-4-[[(2S)-3-cyclohexyl-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-1-pyridinyl]propanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate (PubChem CID 11007272) has the molecular formula C47H56N4O7 and a molecular weight of 788.99 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(2S)-3-cyclohexyl-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-1-pyridinyl]propanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[(2S)-3-cyclohexyl-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-1-pyridinyl]propanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate |
|---|---|
| PubChem CID | 11007272 |
| Molecular Formula | C47H56N4O7 |
| Molecular Weight | 788.99 g/mol |
| Exact Mass | 788.41 |
| IUPAC Name | ethyl (E,4S)-4-[[(2S)-3-cyclohexyl-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-1-pyridinyl]propanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)[C@H](CC1CCCCC1)n1cccc(NC(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C47H56N4O7/c1-5-57-42(53)31-29-38(28-30-41(52)50-47(35-21-12-7-13-22-35,36-23-14-8-15-24-36)37-25-16-9-17-26-37)48-43(54)40(33-34-19-10-6-11-20-34)51-32-18-27-39(44(51)55)49-45(56)58-46(2,3)4/h7-9,12-18,21-27,29,31-32,34,38,40H,5-6,10-11,19-20,28,30,33H2,1-4H3,(H,48,54)(H,49,56)(H,50,52)/b31-29+/t38-,40-/m0/s1 |
| InChIKey | BJZVWHOXHLOQHF-KGAHMXHJSA-N |
| XLogP | 8.20 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.99 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|