C50H46F2N4O7 — CID 10887400
ethyl (E,4S)-4-[[(2S)-3-(3,4-difluorophenyl)-2-[2-oxo-3-(phenylmethoxycarbonylamino)-1-pyridinyl]propanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate (PubChem CID 10887400) has the molecular formula C50H46F2N4O7 and a molecular weight of 852.94 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(2S)-3-(3,4-difluorophenyl)-2-[2-oxo-3-(phenylmethoxycarbonylamino)-1-pyridinyl]propanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[(2S)-3-(3,4-difluorophenyl)-2-[2-oxo-3-(phenylmethoxycarbonylamino)-1-pyridinyl]propanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate |
|---|---|
| PubChem CID | 10887400 |
| Molecular Formula | C50H46F2N4O7 |
| Molecular Weight | 852.94 g/mol |
| Exact Mass | 852.33 |
| IUPAC Name | ethyl (E,4S)-4-[[(2S)-3-(3,4-difluorophenyl)-2-[2-oxo-3-(phenylmethoxycarbonylamino)-1-pyridinyl]propanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)[C@H](Cc1ccc(F)c(F)c1)n1cccc(NC(=O)OCc2ccccc2)c1=O |
| InChI | InChI=1S/C50H46F2N4O7/c1-2-62-46(58)30-27-40(26-29-45(57)55-50(37-18-9-4-10-19-37,38-20-11-5-12-21-38)39-22-13-6-14-23-39)53-47(59)44(33-36-25-28-41(51)42(52)32-36)56-31-15-24-43(48(56)60)54-49(61)63-34-35-16-7-3-8-17-35/h3-25,27-28,30-32,40,44H,2,26,29,33-34H2,1H3,(H,53,59)(H,54,61)(H,55,57)/b30-27+/t40-,44-/m0/s1 |
| InChIKey | VDOBHRUJVDWHNU-RHMTZRKJSA-N |
| XLogP | 8.15 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.94 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|