C49H52N4O8 — CID 10653026
ethyl (E,4S)-4-[[(2S)-2-[[(2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate (PubChem CID 10653026) has the molecular formula C49H52N4O8 and a molecular weight of 824.98 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(2S)-2-[[(2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[(2S)-2-[[(2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate |
|---|---|
| PubChem CID | 10653026 |
| Molecular Formula | C49H52N4O8 |
| Molecular Weight | 824.98 g/mol |
| Exact Mass | 824.38 |
| IUPAC Name | ethyl (E,4S)-4-[[(2S)-2-[[(2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)OCc1ccccc1)[C@@H](C)O |
| InChI | InChI=1S/C49H52N4O8/c1-3-60-44(56)32-30-41(29-31-43(55)53-49(38-23-13-6-14-24-38,39-25-15-7-16-26-39)40-27-17-8-18-28-40)50-46(57)42(33-36-19-9-4-10-20-36)51-47(58)45(35(2)54)52-48(59)61-34-37-21-11-5-12-22-37/h4-28,30,32,35,41-42,45,54H,3,29,31,33-34H2,1-2H3,(H,50,57)(H,51,58)(H,52,59)(H,53,55)/b32-30+/t35-,41+,42+,45+/m1/s1 |
| InChIKey | YLWGZUZFULBQHY-QPIZOJQQSA-N |
| XLogP | 5.88 |
| TPSA | 172.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.98 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|