C32H43N5O7 — CID 6478282
ethyl (E,4S)-7-amino-4-[[(2S)-2-[[(2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoyl]amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate (PubChem CID 6478282) has the molecular formula C32H43N5O7 and a molecular weight of 609.72 g/mol. Its IUPAC name is ethyl (E,4S)-7-amino-4-[[(2S)-2-[[(2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoyl]amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate.
| Compound Name | ethyl (E,4S)-7-amino-4-[[(2S)-2-[[(2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoyl]amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate |
|---|---|
| PubChem CID | 6478282 |
| Molecular Formula | C32H43N5O7 |
| Molecular Weight | 609.72 g/mol |
| Exact Mass | 609.32 |
| IUPAC Name | ethyl (E,4S)-7-amino-4-[[(2S)-2-[[(2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoyl]amino]-3-phenylpropanoyl]amino]-7-oxohept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(N)=O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCCN)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H43N5O7/c1-2-43-29(39)19-17-25(16-18-28(34)38)35-31(41)27(21-23-11-5-3-6-12-23)36-30(40)26(15-9-10-20-33)37-32(42)44-22-24-13-7-4-8-14-24/h3-8,11-14,17,19,25-27H,2,9-10,15-16,18,20-22,33H2,1H3,(H2,34,38)(H,35,41)(H,36,40)(H,37,42)/b19-17+/t25-,26-,27-/m0/s1 |
| InChIKey | XWNLLBWIUJTPNE-MWAXCLHBSA-N |
| XLogP | 2.01 |
| TPSA | 191.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.72 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|