C31H47N5O7 — CID 11296370
ethyl (E,4S)-4-[[(2S)-2-[[(2R)-6-amino-2-(phenylmethoxycarbonylamino)hexanoyl]amino]-4-methylpentanoyl]amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate (PubChem CID 11296370) has the molecular formula C31H47N5O7 and a molecular weight of 601.75 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(2S)-2-[[(2R)-6-amino-2-(phenylmethoxycarbonylamino)hexanoyl]amino]-4-methylpentanoyl]amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[(2S)-2-[[(2R)-6-amino-2-(phenylmethoxycarbonylamino)hexanoyl]amino]-4-methylpentanoyl]amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate |
|---|---|
| PubChem CID | 11296370 |
| Molecular Formula | C31H47N5O7 |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.35 |
| IUPAC Name | ethyl (E,4S)-4-[[(2S)-2-[[(2R)-6-amino-2-(phenylmethoxycarbonylamino)hexanoyl]amino]-4-methylpentanoyl]amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CCCCN)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H47N5O7/c1-4-42-27(37)14-13-24(19-23-15-17-33-28(23)38)34-30(40)26(18-21(2)3)35-29(39)25(12-8-9-16-32)36-31(41)43-20-22-10-6-5-7-11-22/h5-7,10-11,13-14,21,23-26H,4,8-9,12,15-20,32H2,1-3H3,(H,33,38)(H,34,40)(H,35,39)(H,36,41)/b14-13+/t23-,24+,25+,26-/m0/s1 |
| InChIKey | RBBLWOGGTXQHPA-VNSYRQSJSA-N |
| XLogP | 2.07 |
| TPSA | 177.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|