C32H49N5O9S — CID 91542837
ethyl (4S)-4-[[(2S)-2-[[(2S)-6-(methanesulfonamido)-2-(phenylmethoxycarbonylamino)hexanoyl]amino]-4-methylpentanoyl]amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate (PubChem CID 91542837) has the molecular formula C32H49N5O9S and a molecular weight of 679.84 g/mol. Its IUPAC name is ethyl (4S)-4-[[(2S)-2-[[(2S)-6-(methanesulfonamido)-2-(phenylmethoxycarbonylamino)hexanoyl]amino]-4-methylpentanoyl]amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate.
| Compound Name | ethyl (4S)-4-[[(2S)-2-[[(2S)-6-(methanesulfonamido)-2-(phenylmethoxycarbonylamino)hexanoyl]amino]-4-methylpentanoyl]amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate |
|---|---|
| PubChem CID | 91542837 |
| Molecular Formula | C32H49N5O9S |
| Molecular Weight | 679.84 g/mol |
| Exact Mass | 679.33 |
| IUPAC Name | ethyl (4S)-4-[[(2S)-2-[[(2S)-6-(methanesulfonamido)-2-(phenylmethoxycarbonylamino)hexanoyl]amino]-4-methylpentanoyl]amino]-5-[(3S)-2-oxopyrrolidin-3-yl]pent-2-enoate |
| SMILES | CCOC(=O)C=C[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCNS(C)(=O)=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H49N5O9S/c1-5-45-28(38)15-14-25(20-24-16-18-33-29(24)39)35-31(41)27(19-22(2)3)36-30(40)26(13-9-10-17-34-47(4,43)44)37-32(42)46-21-23-11-7-6-8-12-23/h6-8,11-12,14-15,22,24-27,34H,5,9-10,13,16-21H2,1-4H3,(H,33,39)(H,35,41)(H,36,40)(H,37,42)/t24-,25+,26-,27-/m0/s1 |
| InChIKey | BWNPJQVEBAWWAB-XUJYPJAKSA-N |
| XLogP | 1.66 |
| TPSA | 198.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.84 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|