C31H48N6O8 — CID 143078314
ethyl (E,4S)-4-[[(2S)-2-[[5-(carbamoylamino)-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-4-methylpentanoyl]amino]-5-[(3S)-2-hydroxypyrrolidin-3-yl]pent-2-enoate (PubChem CID 143078314) has the molecular formula C31H48N6O8 and a molecular weight of 632.76 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(2S)-2-[[5-(carbamoylamino)-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-4-methylpentanoyl]amino]-5-[(3S)-2-hydroxypyrrolidin-3-yl]pent-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[(2S)-2-[[5-(carbamoylamino)-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-4-methylpentanoyl]amino]-5-[(3S)-2-hydroxypyrrolidin-3-yl]pent-2-enoate |
|---|---|
| PubChem CID | 143078314 |
| Molecular Formula | C31H48N6O8 |
| Molecular Weight | 632.76 g/mol |
| Exact Mass | 632.35 |
| IUPAC Name | ethyl (E,4S)-4-[[(2S)-2-[[5-(carbamoylamino)-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-4-methylpentanoyl]amino]-5-[(3S)-2-hydroxypyrrolidin-3-yl]pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1O)NC(=O)[C@H](CC(C)C)NC(=O)C(CCCNC(N)=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H48N6O8/c1-4-44-26(38)13-12-23(18-22-14-16-33-27(22)39)35-29(41)25(17-20(2)3)36-28(40)24(11-8-15-34-30(32)42)37-31(43)45-19-21-9-6-5-7-10-21/h5-7,9-10,12-13,20,22-25,27,33,39H,4,8,11,14-19H2,1-3H3,(H,35,41)(H,36,40)(H,37,43)(H3,32,34,42)/b13-12+/t22-,23+,24?,25-,27?/m0/s1 |
| InChIKey | DFJLYEFIESDQKG-OXMZTTKESA-N |
| XLogP | 1.18 |
| TPSA | 210.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.76 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|