C50H54N4O7S — CID 10700778
ethyl (E,4S)-4-[[(2S)-2-[[(2S)-4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate (PubChem CID 10700778) has the molecular formula C50H54N4O7S and a molecular weight of 855.07 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(2S)-2-[[(2S)-4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[(2S)-2-[[(2S)-4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate |
|---|---|
| PubChem CID | 10700778 |
| Molecular Formula | C50H54N4O7S |
| Molecular Weight | 855.07 g/mol |
| Exact Mass | 854.37 |
| IUPAC Name | ethyl (E,4S)-4-[[(2S)-2-[[(2S)-4-methylsulfanyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-phenylpropanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCSC)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C50H54N4O7S/c1-3-60-46(56)32-30-42(29-31-45(55)54-50(39-23-13-6-14-24-39,40-25-15-7-16-26-40)41-27-17-8-18-28-41)51-48(58)44(35-37-19-9-4-10-20-37)52-47(57)43(33-34-62-2)53-49(59)61-36-38-21-11-5-12-22-38/h4-28,30,32,42-44H,3,29,31,33-36H2,1-2H3,(H,51,58)(H,52,57)(H,53,59)(H,54,55)/b32-30+/t42-,43-,44-/m0/s1 |
| InChIKey | UQMWTTSCDQLSMT-TVZZAWFASA-N |
| XLogP | 7.25 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.07 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|