C46H54N4O7 — CID 10581057
ethyl (E,4S)-4-[[(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]butanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate (PubChem CID 10581057) has the molecular formula C46H54N4O7 and a molecular weight of 774.96 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]butanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]butanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate |
|---|---|
| PubChem CID | 10581057 |
| Molecular Formula | C46H54N4O7 |
| Molecular Weight | 774.96 g/mol |
| Exact Mass | 774.40 |
| IUPAC Name | ethyl (E,4S)-4-[[(2S)-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]butanoyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)[C@H](CC)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C46H54N4O7/c1-5-39(48-44(54)40(31-33(3)4)49-45(55)57-32-34-19-11-7-12-20-34)43(53)47-38(28-30-42(52)56-6-2)27-29-41(51)50-46(35-21-13-8-14-22-35,36-23-15-9-16-24-36)37-25-17-10-18-26-37/h7-26,28,30,33,38-40H,5-6,27,29,31-32H2,1-4H3,(H,47,53)(H,48,54)(H,49,55)(H,50,51)/b30-28+/t38-,39-,40-/m0/s1 |
| InChIKey | VTKKEEXQDBZKHX-VPWVPUFWSA-N |
| XLogP | 6.71 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.96 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|