C40H44N4O7 — CID 10908620
ethyl (E,4S)-4-[[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-1-pyridinyl]acetyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate (PubChem CID 10908620) has the molecular formula C40H44N4O7 and a molecular weight of 692.81 g/mol. Its IUPAC name is ethyl (E,4S)-4-[[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-1-pyridinyl]acetyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate.
| Compound Name | ethyl (E,4S)-4-[[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-1-pyridinyl]acetyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate |
|---|---|
| PubChem CID | 10908620 |
| Molecular Formula | C40H44N4O7 |
| Molecular Weight | 692.81 g/mol |
| Exact Mass | 692.32 |
| IUPAC Name | ethyl (E,4S)-4-[[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxo-1-pyridinyl]acetyl]amino]-7-oxo-7-(tritylamino)hept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)Cn1cccc(NC(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C40H44N4O7/c1-5-50-36(47)26-24-32(41-35(46)28-44-27-15-22-33(37(44)48)42-38(49)51-39(2,3)4)23-25-34(45)43-40(29-16-9-6-10-17-29,30-18-11-7-12-19-30)31-20-13-8-14-21-31/h6-22,24,26-27,32H,5,23,25,28H2,1-4H3,(H,41,46)(H,42,49)(H,43,45)/b26-24+/t32-/m0/s1 |
| InChIKey | SJGYMMDJCBLRAU-GJHRFRTNSA-N |
| XLogP | 5.69 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.81 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|