C22H26N4O5 — CID 59038132
benzyl N-[1-[2-[[(E,4S)-7-amino-7-oxohept-2-en-4-yl]amino]-2-oxoethyl]-2-oxo-3-pyridinyl]carbamate (PubChem CID 59038132) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is benzyl N-[1-[2-[[(E,4S)-7-amino-7-oxohept-2-en-4-yl]amino]-2-oxoethyl]-2-oxo-3-pyridinyl]carbamate.
| Compound Name | benzyl N-[1-[2-[[(E,4S)-7-amino-7-oxohept-2-en-4-yl]amino]-2-oxoethyl]-2-oxo-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 59038132 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | benzyl N-[1-[2-[[(E,4S)-7-amino-7-oxohept-2-en-4-yl]amino]-2-oxoethyl]-2-oxo-3-pyridinyl]carbamate |
| SMILES | C/C=C/[C@H](CCC(N)=O)NC(=O)Cn1cccc(NC(=O)OCc2ccccc2)c1=O |
| InChI | InChI=1S/C22H26N4O5/c1-2-7-17(11-12-19(23)27)24-20(28)14-26-13-6-10-18(21(26)29)25-22(30)31-15-16-8-4-3-5-9-16/h2-10,13,17H,11-12,14-15H2,1H3,(H2,23,27)(H,24,28)(H,25,30)/b7-2+/t17-/m1/s1 |
| InChIKey | UOHJDIBTMVFJQK-WJCMJQHKSA-N |
| XLogP | 1.92 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|